C21H30O4 — CID 15984521
methyl (3aS,5aR,10aR)-8-formyl-6-hydroxy-5a-methyl-1-propan-2-yl-2,3,4,5,6,7,10,10a-octahydrocyclohepta[g]indene-3a-carboxylate (PubChem CID 15984521) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is methyl (3aS,5aR,10aR)-8-formyl-6-hydroxy-5a-methyl-1-propan-2-yl-2,3,4,5,6,7,10,10a-octahydrocyclohepta[g]indene-3a-carboxylate.
| Compound Name | methyl (3aS,5aR,10aR)-8-formyl-6-hydroxy-5a-methyl-1-propan-2-yl-2,3,4,5,6,7,10,10a-octahydrocyclohepta[g]indene-3a-carboxylate |
|---|---|
| PubChem CID | 15984521 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | methyl (3aS,5aR,10aR)-8-formyl-6-hydroxy-5a-methyl-1-propan-2-yl-2,3,4,5,6,7,10,10a-octahydrocyclohepta[g]indene-3a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C(C)C)=C1[C@H]1CC=C(C=O)CC(O)[C@]1(C)CC2 |
| InChI | InChI=1S/C21H30O4/c1-13(2)15-7-8-21(19(24)25-4)10-9-20(3)16(18(15)21)6-5-14(12-22)11-17(20)23/h5,12-13,16-17,23H,6-11H2,1-4H3/t16-,17?,20-,21+/m1/s1 |
| InChIKey | IOIMBQIGAQVJCQ-IZBPLUDHSA-N |
| XLogP | 3.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|