C25H35NaO7 — CID 102012688
sodium (3aR,5aR,6S)-3a,5a-dimethyl-1-propan-2-yl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7-hexahydrocyclohepta[e]indene-8-carboxylate (PubChem CID 102012688) has the molecular formula C25H35NaO7 and a molecular weight of 470.54 g/mol. Its IUPAC name is sodium (3aR,5aR,6S)-3a,5a-dimethyl-1-propan-2-yl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7-hexahydrocyclohepta[e]indene-8-carboxylate.
| Compound Name | sodium (3aR,5aR,6S)-3a,5a-dimethyl-1-propan-2-yl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7-hexahydrocyclohepta[e]indene-8-carboxylate |
|---|---|
| PubChem CID | 102012688 |
| Molecular Formula | C25H35NaO7 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | sodium (3aR,5aR,6S)-3a,5a-dimethyl-1-propan-2-yl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7-hexahydrocyclohepta[e]indene-8-carboxylate |
| SMILES | CC(C)C1=C2C3=CC=C(C(=O)[O-])C[C@H](O[C@@H]4OC[C@@H](O)[C@H](O)[C@H]4O)[C@]3(C)CC[C@@]2(C)CC1.[Na+] |
| InChI | InChI=1S/C25H36O7.Na/c1-13(2)15-7-8-24(3)9-10-25(4)16(19(15)24)6-5-14(22(29)30)11-18(25)32-23-21(28)20(27)17(26)12-31-23;/h5-6,13,17-18,20-21,23,26-28H,7-12H2,1-4H3,(H,29,30);/q;+1/p-1/t17-,18+,20+,21-,23+,24-,25-;/m1./s1 |
| InChIKey | PIDSIENWTJMQMY-JRPDWERQSA-M |
| XLogP | -1.63 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |