C34H39NO3 — CID 177144233
[(5aR,6S)-3a,5a-dimethyl-8-(phenylcarbamoyl)-1-propan-2-yl-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-6-yl] 4-methylbenzoate (PubChem CID 177144233) has the molecular formula C34H39NO3 and a molecular weight of 509.69 g/mol. Its IUPAC name is [(5aR,6S)-3a,5a-dimethyl-8-(phenylcarbamoyl)-1-propan-2-yl-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-6-yl] 4-methylbenzoate.
| Compound Name | [(5aR,6S)-3a,5a-dimethyl-8-(phenylcarbamoyl)-1-propan-2-yl-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-6-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 177144233 |
| Molecular Formula | C34H39NO3 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | [(5aR,6S)-3a,5a-dimethyl-8-(phenylcarbamoyl)-1-propan-2-yl-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-6-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O[C@H]2CC(C(=O)Nc3ccccc3)=CC=C3C4=C(C(C)C)CCC4(C)CC[C@]32C)cc1 |
| InChI | InChI=1S/C34H39NO3/c1-22(2)27-17-18-33(4)19-20-34(5)28(30(27)33)16-15-25(31(36)35-26-9-7-6-8-10-26)21-29(34)38-32(37)24-13-11-23(3)12-14-24/h6-16,22,29H,17-21H2,1-5H3,(H,35,36)/t29-,33?,34+/m0/s1 |
| InChIKey | BRYSZWUYAKFIES-HSJJHHFSSA-N |
| XLogP | 7.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |