C33H37NO3 — CID 177144268
[(3aR,5aR,6S)-3a,5a-dimethyl-8-(phenylcarbamoyl)-1-propan-2-yl-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-6-yl] benzoate (PubChem CID 177144268) has the molecular formula C33H37NO3 and a molecular weight of 495.66 g/mol. Its IUPAC name is [(3aR,5aR,6S)-3a,5a-dimethyl-8-(phenylcarbamoyl)-1-propan-2-yl-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-6-yl] benzoate.
| Compound Name | [(3aR,5aR,6S)-3a,5a-dimethyl-8-(phenylcarbamoyl)-1-propan-2-yl-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-6-yl] benzoate |
|---|---|
| PubChem CID | 177144268 |
| Molecular Formula | C33H37NO3 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | [(3aR,5aR,6S)-3a,5a-dimethyl-8-(phenylcarbamoyl)-1-propan-2-yl-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-6-yl] benzoate |
| SMILES | CC(C)C1=C2C3=CC=C(C(=O)Nc4ccccc4)C[C@H](OC(=O)c4ccccc4)[C@]3(C)CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C33H37NO3/c1-22(2)26-17-18-32(3)19-20-33(4)27(29(26)32)16-15-24(30(35)34-25-13-9-6-10-14-25)21-28(33)37-31(36)23-11-7-5-8-12-23/h5-16,22,28H,17-21H2,1-4H3,(H,34,35)/t28-,32+,33+/m0/s1 |
| InChIKey | JWRSJQUJRPPZNA-XEUSQTKLSA-N |
| XLogP | 7.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |