C22H31NO — CID 177144117
N-[[(1S,4R,14S)-4-methyl-7-propan-2-yl-15-oxatetracyclo[7.6.0.01,14.04,8]pentadeca-7,9,11-trien-12-yl]methyl]cyclopropanamine (PubChem CID 177144117) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is N-[[(1S,4R,14S)-4-methyl-7-propan-2-yl-15-oxatetracyclo[7.6.0.01,14.04,8]pentadeca-7,9,11-trien-12-yl]methyl]cyclopropanamine.
| Compound Name | N-[[(1S,4R,14S)-4-methyl-7-propan-2-yl-15-oxatetracyclo[7.6.0.01,14.04,8]pentadeca-7,9,11-trien-12-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 177144117 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | N-[[(1S,4R,14S)-4-methyl-7-propan-2-yl-15-oxatetracyclo[7.6.0.01,14.04,8]pentadeca-7,9,11-trien-12-yl]methyl]cyclopropanamine |
| SMILES | CC(C)C1=C2C3=CC=C(CNC4CC4)C[C@@H]4O[C@@]34CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C22H31NO/c1-14(2)17-8-9-21(3)10-11-22-18(20(17)21)7-4-15(12-19(22)24-22)13-23-16-5-6-16/h4,7,14,16,19,23H,5-6,8-13H2,1-3H3/t19-,21+,22-/m0/s1 |
| InChIKey | XLNMLBNTKDXLOJ-NNWRFLSQSA-N |
| XLogP | 4.68 |
| TPSA | 24.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|