C26H35NO2S — CID 177144247
N-[(6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl)methyl]-3-methylbenzenesulfinamide (PubChem CID 177144247) has the molecular formula C26H35NO2S and a molecular weight of 425.64 g/mol. Its IUPAC name is N-[(6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl)methyl]-3-methylbenzenesulfinamide.
| Compound Name | N-[(6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl)methyl]-3-methylbenzenesulfinamide |
|---|---|
| PubChem CID | 177144247 |
| Molecular Formula | C26H35NO2S |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | N-[(6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl)methyl]-3-methylbenzenesulfinamide |
| SMILES | Cc1cccc(S(=O)NCC2=CC=C3C4=C(C(C)C)CCC4(C)CCC3C(O)C2)c1 |
| InChI | InChI=1S/C26H35NO2S/c1-17(2)21-10-12-26(4)13-11-22-23(25(21)26)9-8-19(15-24(22)28)16-27-30(29)20-7-5-6-18(3)14-20/h5-9,14,17,22,24,27-28H,10-13,15-16H2,1-4H3 |
| InChIKey | OIJCVZBAHQMKPR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |