C12H13F2NO — CID 126781653
3,3-difluoro-N-(3-methylphenyl)cyclobutane-1-carboxamide (PubChem CID 126781653) has the molecular formula C12H13F2NO and a molecular weight of 225.24 g/mol. Its IUPAC name is 3,3-difluoro-N-(3-methylphenyl)cyclobutane-1-carboxamide.
| Compound Name | 3,3-difluoro-N-(3-methylphenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 126781653 |
| Molecular Formula | C12H13F2NO |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 3,3-difluoro-N-(3-methylphenyl)cyclobutane-1-carboxamide |
| SMILES | Cc1cccc(NC(=O)C2CC(F)(F)C2)c1 |
| InChI | InChI=1S/C12H13F2NO/c1-8-3-2-4-10(5-8)15-11(16)9-6-12(13,14)7-9/h2-5,9H,6-7H2,1H3,(H,15,16) |
| InChIKey | LXVWKIBVMVGDFD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |