C13H17NO3S — CID 110856707
N-(3-methylphenyl)-1,1-dioxothiane-4-carboxamide (PubChem CID 110856707) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is N-(3-methylphenyl)-1,1-dioxothiane-4-carboxamide.
| Compound Name | N-(3-methylphenyl)-1,1-dioxothiane-4-carboxamide |
|---|---|
| PubChem CID | 110856707 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N-(3-methylphenyl)-1,1-dioxothiane-4-carboxamide |
| SMILES | Cc1cccc(NC(=O)C2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C13H17NO3S/c1-10-3-2-4-12(9-10)14-13(15)11-5-7-18(16,17)8-6-11/h2-4,9,11H,5-8H2,1H3,(H,14,15) |
| InChIKey | VQTIYJKFGCEPEU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |