C12H20N2OS — CID 115627607
N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]thian-4-amine (PubChem CID 115627607) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]thian-4-amine.
| Compound Name | N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]thian-4-amine |
|---|---|
| PubChem CID | 115627607 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]thian-4-amine |
| SMILES | CC(C)c1cc(CNC2CCSCC2)on1 |
| InChI | InChI=1S/C12H20N2OS/c1-9(2)12-7-11(15-14-12)8-13-10-3-5-16-6-4-10/h7,9-10,13H,3-6,8H2,1-2H3 |
| InChIKey | RENYXACVRZJJDC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |