About N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pentan-3-amine
N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pentan-3-amine (PubChem CID 115720213) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pentan-3-amine.
Molecular Properties
| Compound Name | N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pentan-3-amine |
| PubChem CID | 115720213 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pentan-3-amine |
| SMILES | CCC(CC)NCc1cc(C(C)C)no1 |
| InChI | InChI=1S/C12H22N2O/c1-5-10(6-2)13-8-11-7-12(9(3)4)14-15-11/h7,9-10,13H,5-6,8H2,1-4H3 |
| InChIKey | XVNJNOSWNNCZPO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pentan-3-amine?
The IUPAC name of N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pentan-3-amine (CID 115720213) is N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pentan-3-amine.
What is the SMILES notation for N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pentan-3-amine?
The canonical SMILES for N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pentan-3-amine is CCC(CC)NCc1cc(C(C)C)no1.
What is the InChIKey of N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pentan-3-amine?
The InChIKey is XVNJNOSWNNCZPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O/c1-5-10(6-2)13-8-11-7-12(9(3)4)14-15-11/h7,9-10,13H,5-6,8H2,1-4H3.
What are the key properties of N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pentan-3-amine?
N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pentan-3-amine has a molecular weight of 210.32 g/mol, XLogP of 3.08, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pentan-3-amine is sourced from PubChem (CID 115720213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).