C9H17N3O3S — CID 71997313
3-pentan-3-yl-5-[(sulfamoylamino)methyl]-1,2-oxazole (PubChem CID 71997313) has the molecular formula C9H17N3O3S and a molecular weight of 247.32 g/mol. Its IUPAC name is 3-pentan-3-yl-5-[(sulfamoylamino)methyl]-1,2-oxazole.
| Compound Name | 3-pentan-3-yl-5-[(sulfamoylamino)methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 71997313 |
| Molecular Formula | C9H17N3O3S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 3-pentan-3-yl-5-[(sulfamoylamino)methyl]-1,2-oxazole |
| SMILES | CCC(CC)c1cc(CNS(N)(=O)=O)on1 |
| InChI | InChI=1S/C9H17N3O3S/c1-3-7(4-2)9-5-8(15-12-9)6-11-16(10,13)14/h5,7,11H,3-4,6H2,1-2H3,(H2,10,13,14) |
| InChIKey | IYYLYSNNLLWNEY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |