C36H48O3Si — CID 10745368
(4S,4aR,6aR)-4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4a,6a-dimethyl-9-propan-2-yl-5,6,7,8-tetrahydro-4H-cyclopenta[f]isochromen-2-one (PubChem CID 10745368) has the molecular formula C36H48O3Si and a molecular weight of 556.86 g/mol. Its IUPAC name is (4S,4aR,6aR)-4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4a,6a-dimethyl-9-propan-2-yl-5,6,7,8-tetrahydro-4H-cyclopenta[f]isochromen-2-one.
| Compound Name | (4S,4aR,6aR)-4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4a,6a-dimethyl-9-propan-2-yl-5,6,7,8-tetrahydro-4H-cyclopenta[f]isochromen-2-one |
|---|---|
| PubChem CID | 10745368 |
| Molecular Formula | C36H48O3Si |
| Molecular Weight | 556.86 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | (4S,4aR,6aR)-4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-4a,6a-dimethyl-9-propan-2-yl-5,6,7,8-tetrahydro-4H-cyclopenta[f]isochromen-2-one |
| SMILES | CC(C)C1=C2C3=CC(=O)O[C@@H](CCCO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)[C@]3(C)CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C36H48O3Si/c1-26(2)29-20-21-35(6)22-23-36(7)30(33(29)35)25-32(37)39-31(36)19-14-24-38-40(34(3,4)5,27-15-10-8-11-16-27)28-17-12-9-13-18-28/h8-13,15-18,25-26,31H,14,19-24H2,1-7H3/t31-,35+,36+/m0/s1 |
| InChIKey | KHWWLZWQARROJU-BTLFPPEZSA-N |
| XLogP | 7.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.86 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|