C30H38O2Si — CID 117070662
4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-10-methyltricyclo[4.4.0.02,10]dec-6-en-3-one (PubChem CID 117070662) has the molecular formula C30H38O2Si and a molecular weight of 458.72 g/mol. Its IUPAC name is 4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-10-methyltricyclo[4.4.0.02,10]dec-6-en-3-one.
| Compound Name | 4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-10-methyltricyclo[4.4.0.02,10]dec-6-en-3-one |
|---|---|
| PubChem CID | 117070662 |
| Molecular Formula | C30H38O2Si |
| Molecular Weight | 458.72 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-10-methyltricyclo[4.4.0.02,10]dec-6-en-3-one |
| SMILES | CC12CCC=C3CC(CCCO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)C(=O)C1C32 |
| InChI | InChI=1S/C30H38O2Si/c1-29(2,3)33(24-15-7-5-8-16-24,25-17-9-6-10-18-25)32-20-12-14-23-21-22-13-11-19-30(4)26(22)27(30)28(23)31/h5-10,13,15-18,23,26-27H,11-12,14,19-21H2,1-4H3 |
| InChIKey | SVXWLSYXLYSVIN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.72 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|