C19H26O2 — CID 177144270
(3aS,6S)-6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carbaldehyde (PubChem CID 177144270) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is (3aS,6S)-6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carbaldehyde.
| Compound Name | (3aS,6S)-6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carbaldehyde |
|---|---|
| PubChem CID | 177144270 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (3aS,6S)-6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]indene-8-carbaldehyde |
| SMILES | CC(C)C1=C2C3=CC=C(C=O)C[C@H](O)C3CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C19H26O2/c1-12(2)14-6-8-19(3)9-7-15-16(18(14)19)5-4-13(11-20)10-17(15)21/h4-5,11-12,15,17,21H,6-10H2,1-3H3/t15?,17-,19+/m0/s1 |
| InChIKey | WEXQFMZRHXHOBF-IYSUZNMVSA-N |
| XLogP | 3.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|