C18H30O3Si — CID 123400363
1-[5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)phenyl]cyclopentan-1-ol (PubChem CID 123400363) has the molecular formula C18H30O3Si and a molecular weight of 322.52 g/mol. Its IUPAC name is 1-[5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)phenyl]cyclopentan-1-ol.
| Compound Name | 1-[5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)phenyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 123400363 |
| Molecular Formula | C18H30O3Si |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 1-[5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)phenyl]cyclopentan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(CO)c(C2(O)CCCC2)c1 |
| InChI | InChI=1S/C18H30O3Si/c1-17(2,3)22(4,5)21-15-9-8-14(13-19)16(12-15)18(20)10-6-7-11-18/h8-9,12,19-20H,6-7,10-11,13H2,1-5H3 |
| InChIKey | LBQILDAJUIDDRP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|