C24H28N4O4SSi — CID 136650245
4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(7-isocyano-2,1,3-benzothiadiazol-4-yl)-7-methyl-4,7-epoxyisoindole-1,3-diol (PubChem CID 136650245) has the molecular formula C24H28N4O4SSi and a molecular weight of 496.67 g/mol. Its IUPAC name is 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(7-isocyano-2,1,3-benzothiadiazol-4-yl)-7-methyl-4,7-epoxyisoindole-1,3-diol.
| Compound Name | 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(7-isocyano-2,1,3-benzothiadiazol-4-yl)-7-methyl-4,7-epoxyisoindole-1,3-diol |
|---|---|
| PubChem CID | 136650245 |
| Molecular Formula | C24H28N4O4SSi |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(7-isocyano-2,1,3-benzothiadiazol-4-yl)-7-methyl-4,7-epoxyisoindole-1,3-diol |
| SMILES | [C-]#[N+]c1ccc(-n2c(O)c3c(c2O)C2(CCO[Si](C)(C)C(C)(C)C)C=CC3(C)O2)c2nsnc12 |
| InChI | InChI=1S/C24H28N4O4SSi/c1-22(2,3)34(6,7)31-13-12-24-11-10-23(4,32-24)16-17(24)21(30)28(20(16)29)15-9-8-14(25-5)18-19(15)27-33-26-18/h8-11,29-30H,12-13H2,1-4,6-7H3 |
| InChIKey | UUMMIJFQHNZWOM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 93.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|