C27H32N2O4Si — CID 90899223
7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(4-isocyanonaphthalen-1-yl)-5,6-dihydro-4H-4,7-epoxyisoindole-1,3-diol (PubChem CID 90899223) has the molecular formula C27H32N2O4Si and a molecular weight of 476.65 g/mol. Its IUPAC name is 7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(4-isocyanonaphthalen-1-yl)-5,6-dihydro-4H-4,7-epoxyisoindole-1,3-diol.
| Compound Name | 7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(4-isocyanonaphthalen-1-yl)-5,6-dihydro-4H-4,7-epoxyisoindole-1,3-diol |
|---|---|
| PubChem CID | 90899223 |
| Molecular Formula | C27H32N2O4Si |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(4-isocyanonaphthalen-1-yl)-5,6-dihydro-4H-4,7-epoxyisoindole-1,3-diol |
| SMILES | [C-]#[N+]c1ccc(-n2c(O)c3c(c2O)C2(CCO[Si](C)(C)C(C)(C)C)CCC3O2)c2ccccc12 |
| InChI | InChI=1S/C27H32N2O4Si/c1-26(2,3)34(5,6)32-16-15-27-14-13-21(33-27)22-23(27)25(31)29(24(22)30)20-12-11-19(28-4)17-9-7-8-10-18(17)20/h7-12,21,30-31H,13-16H2,1-3,5-6H3 |
| InChIKey | SZCYUJQWNFSFLL-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 68.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|