C28H34N2O6Si — CID 91517053
(5S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(4-isocyanonaphthalen-1-yl)-7-methyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5,6-tetrol (PubChem CID 91517053) has the molecular formula C28H34N2O6Si and a molecular weight of 522.67 g/mol. Its IUPAC name is (5S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(4-isocyanonaphthalen-1-yl)-7-methyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5,6-tetrol.
| Compound Name | (5S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(4-isocyanonaphthalen-1-yl)-7-methyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5,6-tetrol |
|---|---|
| PubChem CID | 91517053 |
| Molecular Formula | C28H34N2O6Si |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | (5S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(4-isocyanonaphthalen-1-yl)-7-methyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5,6-tetrol |
| SMILES | [C-]#[N+]c1ccc(-n2c(O)c3c(c2O)C2(CCO[Si](C)(C)C(C)(C)C)OC3(C)C(O)[C@@H]2O)c2ccccc12 |
| InChI | InChI=1S/C28H34N2O6Si/c1-26(2,3)37(6,7)35-15-14-28-21-20(27(4,36-28)22(31)23(28)32)24(33)30(25(21)34)19-13-12-18(29-5)16-10-8-9-11-17(16)19/h8-13,22-23,31-34H,14-15H2,1-4,6-7H3/t22?,23-,27?,28?/m0/s1 |
| InChIKey | WFFUFPVWZMQDRS-OBMZIPTRSA-N |
| XLogP | 5.18 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|