C28H23ClN2O5 — CID 59922223
(3aS,5R,7aR)-7-[2-(4-chlorophenoxy)ethyl]-5-hydroxy-2-(4-isocyanonaphthalen-1-yl)-4-methyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 59922223) has the molecular formula C28H23ClN2O5 and a molecular weight of 502.95 g/mol. Its IUPAC name is (3aS,5R,7aR)-7-[2-(4-chlorophenoxy)ethyl]-5-hydroxy-2-(4-isocyanonaphthalen-1-yl)-4-methyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,5R,7aR)-7-[2-(4-chlorophenoxy)ethyl]-5-hydroxy-2-(4-isocyanonaphthalen-1-yl)-4-methyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 59922223 |
| Molecular Formula | C28H23ClN2O5 |
| Molecular Weight | 502.95 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | (3aS,5R,7aR)-7-[2-(4-chlorophenoxy)ethyl]-5-hydroxy-2-(4-isocyanonaphthalen-1-yl)-4-methyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)[C@@H]3[C@H](C2=O)C2(C)OC3(CCOc3ccc(Cl)cc3)C[C@H]2O)c2ccccc12 |
| InChI | InChI=1S/C28H23ClN2O5/c1-27-22(32)15-28(36-27,13-14-35-17-9-7-16(29)8-10-17)24-23(27)25(33)31(26(24)34)21-12-11-20(30-2)18-5-3-4-6-19(18)21/h3-12,22-24,32H,13-15H2,1H3/t22-,23-,24+,27?,28?/m1/s1 |
| InChIKey | JNOOCTYMOHWWDE-ZBYSZADTSA-N |
| XLogP | 4.91 |
| TPSA | 80.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.95 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|