C21H20N2O7 — CID 173091858
(3aS,4S,5R,7aR)-5-hydroxy-7-(2-hydroxyethyl)-4-methyl-2-(4-nitronaphthalen-1-yl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 173091858) has the molecular formula C21H20N2O7 and a molecular weight of 412.40 g/mol. Its IUPAC name is (3aS,4S,5R,7aR)-5-hydroxy-7-(2-hydroxyethyl)-4-methyl-2-(4-nitronaphthalen-1-yl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,4S,5R,7aR)-5-hydroxy-7-(2-hydroxyethyl)-4-methyl-2-(4-nitronaphthalen-1-yl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 173091858 |
| Molecular Formula | C21H20N2O7 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (3aS,4S,5R,7aR)-5-hydroxy-7-(2-hydroxyethyl)-4-methyl-2-(4-nitronaphthalen-1-yl)-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | C[C@@]12OC(CCO)(C[C@H]1O)[C@@H]1C(=O)N(c3ccc([N+](=O)[O-])c4ccccc34)C(=O)[C@@H]12 |
| InChI | InChI=1S/C21H20N2O7/c1-20-15(25)10-21(30-20,8-9-24)17-16(20)18(26)22(19(17)27)13-6-7-14(23(28)29)12-5-3-2-4-11(12)13/h2-7,15-17,24-25H,8-10H2,1H3/t15-,16-,17+,20-,21?/m1/s1 |
| InChIKey | OOUKDDTZLMITRV-NOSRPZSHSA-N |
| XLogP | 1.53 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|