C28H23FN2O5 — CID 90896624
4-[(4S,7S)-7-[2-(4-fluorophenoxy)ethyl]-1,3,5-trihydroxy-4-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile (PubChem CID 90896624) has the molecular formula C28H23FN2O5 and a molecular weight of 486.50 g/mol. Its IUPAC name is 4-[(4S,7S)-7-[2-(4-fluorophenoxy)ethyl]-1,3,5-trihydroxy-4-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(4S,7S)-7-[2-(4-fluorophenoxy)ethyl]-1,3,5-trihydroxy-4-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 90896624 |
| Molecular Formula | C28H23FN2O5 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 4-[(4S,7S)-7-[2-(4-fluorophenoxy)ethyl]-1,3,5-trihydroxy-4-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
| SMILES | C[C@@]12O[C@@](CCOc3ccc(F)cc3)(CC1O)c1c2c(O)n(-c2ccc(C#N)c3ccccc23)c1O |
| InChI | InChI=1S/C28H23FN2O5/c1-27-22(32)14-28(36-27,12-13-35-18-9-7-17(29)8-10-18)24-23(27)25(33)31(26(24)34)21-11-6-16(15-30)19-4-2-3-5-20(19)21/h2-11,22,32-34H,12-14H2,1H3/t22?,27-,28+/m1/s1 |
| InChIKey | ODQVDLKJRSQQJY-MYDYDDKHSA-N |
| XLogP | 4.73 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |