C31H24ClN3O5 — CID 91219555
4-[(4S,7S)-7-[2-(7-chloroquinolin-4-yl)oxyethyl]-1,3,5-trihydroxy-4-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile (PubChem CID 91219555) has the molecular formula C31H24ClN3O5 and a molecular weight of 554.00 g/mol. Its IUPAC name is 4-[(4S,7S)-7-[2-(7-chloroquinolin-4-yl)oxyethyl]-1,3,5-trihydroxy-4-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(4S,7S)-7-[2-(7-chloroquinolin-4-yl)oxyethyl]-1,3,5-trihydroxy-4-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 91219555 |
| Molecular Formula | C31H24ClN3O5 |
| Molecular Weight | 554.00 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 4-[(4S,7S)-7-[2-(7-chloroquinolin-4-yl)oxyethyl]-1,3,5-trihydroxy-4-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
| SMILES | C[C@@]12O[C@@](CCOc3ccnc4cc(Cl)ccc34)(CC1O)c1c2c(O)n(-c2ccc(C#N)c3ccccc23)c1O |
| InChI | InChI=1S/C31H24ClN3O5/c1-30-25(36)15-31(40-30,11-13-39-24-10-12-34-22-14-18(32)7-8-21(22)24)27-26(30)28(37)35(29(27)38)23-9-6-17(16-33)19-4-2-3-5-20(19)23/h2-10,12,14,25,36-38H,11,13,15H2,1H3/t25?,30-,31+/m1/s1 |
| InChIKey | SPQBTHUBJPLZRL-QLWBHHBCSA-N |
| XLogP | 5.79 |
| TPSA | 120.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.00 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |