C28H22ClN5O4 — CID 90922818
4-[(4R,5S,7R)-7-[2-(6-chlorobenzotriazol-1-yl)ethyl]-1,3,5-trihydroxy-4-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile (PubChem CID 90922818) has the molecular formula C28H22ClN5O4 and a molecular weight of 527.97 g/mol. Its IUPAC name is 4-[(4R,5S,7R)-7-[2-(6-chlorobenzotriazol-1-yl)ethyl]-1,3,5-trihydroxy-4-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(4R,5S,7R)-7-[2-(6-chlorobenzotriazol-1-yl)ethyl]-1,3,5-trihydroxy-4-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 90922818 |
| Molecular Formula | C28H22ClN5O4 |
| Molecular Weight | 527.97 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | 4-[(4R,5S,7R)-7-[2-(6-chlorobenzotriazol-1-yl)ethyl]-1,3,5-trihydroxy-4-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
| SMILES | C[C@]12O[C@](CCn3nnc4ccc(Cl)cc43)(C[C@@H]1O)c1c2c(O)n(-c2ccc(C#N)c3ccccc23)c1O |
| InChI | InChI=1S/C28H22ClN5O4/c1-27-22(35)13-28(38-27,10-11-33-21-12-16(29)7-8-19(21)31-32-33)24-23(27)25(36)34(26(24)37)20-9-6-15(14-30)17-4-2-3-5-18(17)20/h2-9,12,22,35-37H,10-11,13H2,1H3/t22-,27-,28+/m0/s1 |
| InChIKey | QOEYBRANGGQTIH-QLCOJLISSA-N |
| XLogP | 4.61 |
| TPSA | 129.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.97 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |