C19H28ClNO3Si — CID 58433537
(2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]butanoic acid (PubChem CID 58433537) has the molecular formula C19H28ClNO3Si and a molecular weight of 381.98 g/mol. Its IUPAC name is (2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]butanoic acid.
| Compound Name | (2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]butanoic acid |
|---|---|
| PubChem CID | 58433537 |
| Molecular Formula | C19H28ClNO3Si |
| Molecular Weight | 381.98 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (2R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]butanoic acid |
| SMILES | [C-]#[N+]c1ccc(C[C@H](CCO[Si](C)(C)C(C)(C)C)C(=O)O)c(C)c1Cl |
| InChI | InChI=1S/C19H28ClNO3Si/c1-13-14(8-9-16(21-5)17(13)20)12-15(18(22)23)10-11-24-25(6,7)19(2,3)4/h8-9,15H,10-12H2,1-4,6-7H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | SOSUVWPYGFOTKY-HNNXBMFYSA-N |
| XLogP | 5.85 |
| TPSA | 50.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.98 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|