C19H28O2Si — CID 11666836
(2aR,7aS)-7a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2a-methyl-2,7-dihydrocyclobuta[a]inden-1-one (PubChem CID 11666836) has the molecular formula C19H28O2Si and a molecular weight of 316.52 g/mol. Its IUPAC name is (2aR,7aS)-7a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2a-methyl-2,7-dihydrocyclobuta[a]inden-1-one.
| Compound Name | (2aR,7aS)-7a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2a-methyl-2,7-dihydrocyclobuta[a]inden-1-one |
|---|---|
| PubChem CID | 11666836 |
| Molecular Formula | C19H28O2Si |
| Molecular Weight | 316.52 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (2aR,7aS)-7a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2a-methyl-2,7-dihydrocyclobuta[a]inden-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]12Cc3ccccc3[C@@]1(C)CC2=O |
| InChI | InChI=1S/C19H28O2Si/c1-17(2,3)22(5,6)21-13-19-11-14-9-7-8-10-15(14)18(19,4)12-16(19)20/h7-10H,11-13H2,1-6H3/t18-,19+/m1/s1 |
| InChIKey | KPVQPQYKJWQWGW-MOPGFXCFSA-N |
| XLogP | 4.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|