C19H26OSi — CID 25192792
[(2aR,7aS)-2a-methyl-1-methylidene-2,7-dihydrocyclobuta[a]inden-7a-yl]methoxy-dimethyl-prop-2-enylsilane (PubChem CID 25192792) has the molecular formula C19H26OSi and a molecular weight of 298.50 g/mol. Its IUPAC name is [(2aR,7aS)-2a-methyl-1-methylidene-2,7-dihydrocyclobuta[a]inden-7a-yl]methoxy-dimethyl-prop-2-enylsilane.
| Compound Name | [(2aR,7aS)-2a-methyl-1-methylidene-2,7-dihydrocyclobuta[a]inden-7a-yl]methoxy-dimethyl-prop-2-enylsilane |
|---|---|
| PubChem CID | 25192792 |
| Molecular Formula | C19H26OSi |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [(2aR,7aS)-2a-methyl-1-methylidene-2,7-dihydrocyclobuta[a]inden-7a-yl]methoxy-dimethyl-prop-2-enylsilane |
| SMILES | C=CC[Si](C)(C)OC[C@]12Cc3ccccc3[C@@]1(C)CC2=C |
| InChI | InChI=1S/C19H26OSi/c1-6-11-21(4,5)20-14-19-13-16-9-7-8-10-17(16)18(19,3)12-15(19)2/h6-10H,1-2,11-14H2,3-5H3/t18-,19+/m1/s1 |
| InChIKey | OTZIIOZIHWBLPH-MOPGFXCFSA-N |
| XLogP | 4.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|