C16H20O2 — CID 122215645
(3aS,8bR)-8b-but-3-enyl-2,2-dimethyl-3a,4-dihydroindeno[1,2-d][1,3]dioxole (PubChem CID 122215645) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (3aS,8bR)-8b-but-3-enyl-2,2-dimethyl-3a,4-dihydroindeno[1,2-d][1,3]dioxole.
| Compound Name | (3aS,8bR)-8b-but-3-enyl-2,2-dimethyl-3a,4-dihydroindeno[1,2-d][1,3]dioxole |
|---|---|
| PubChem CID | 122215645 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (3aS,8bR)-8b-but-3-enyl-2,2-dimethyl-3a,4-dihydroindeno[1,2-d][1,3]dioxole |
| SMILES | C=CCC[C@]12OC(C)(C)O[C@H]1Cc1ccccc12 |
| InChI | InChI=1S/C16H20O2/c1-4-5-10-16-13-9-7-6-8-12(13)11-14(16)17-15(2,3)18-16/h4,6-9,14H,1,5,10-11H2,2-3H3/t14-,16+/m0/s1 |
| InChIKey | RQZPMWCRDBGIRH-GOEBONIOSA-N |
| XLogP | 3.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|