About 2-pent-1-en-3-yl-2,3-dihydro-1H-indene
2-pent-1-en-3-yl-2,3-dihydro-1H-indene (PubChem CID 174911971) has the molecular formula C14H18
and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-pent-1-en-3-yl-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 2-pent-1-en-3-yl-2,3-dihydro-1H-indene |
| PubChem CID | 174911971 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-pent-1-en-3-yl-2,3-dihydro-1H-indene |
| SMILES | C=CC(CC)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C14H18/c1-3-11(4-2)14-9-12-7-5-6-8-13(12)10-14/h3,5-8,11,14H,1,4,9-10H2,2H3 |
| InChIKey | WKPURLQWYDGGHF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-pent-1-en-3-yl-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pent-1-en-3-yl-2,3-dihydro-1H-indene?
The IUPAC name of 2-pent-1-en-3-yl-2,3-dihydro-1H-indene (CID 174911971) is 2-pent-1-en-3-yl-2,3-dihydro-1H-indene.
What is the SMILES notation for 2-pent-1-en-3-yl-2,3-dihydro-1H-indene?
The canonical SMILES for 2-pent-1-en-3-yl-2,3-dihydro-1H-indene is C=CC(CC)C1Cc2ccccc2C1.
What is the InChIKey of 2-pent-1-en-3-yl-2,3-dihydro-1H-indene?
The InChIKey is WKPURLQWYDGGHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18/c1-3-11(4-2)14-9-12-7-5-6-8-13(12)10-14/h3,5-8,11,14H,1,4,9-10H2,2H3.
What are the key properties of 2-pent-1-en-3-yl-2,3-dihydro-1H-indene?
2-pent-1-en-3-yl-2,3-dihydro-1H-indene has a molecular weight of 186.30 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pent-1-en-3-yl-2,3-dihydro-1H-indene is sourced from PubChem (CID 174911971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).