C19H28N2 — CID 43830997
1-butyl-2-N,2-N-bis(prop-2-enyl)-2,3-dihydroindene-1,2-diamine (PubChem CID 43830997) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 1-butyl-2-N,2-N-bis(prop-2-enyl)-2,3-dihydroindene-1,2-diamine.
| Compound Name | 1-butyl-2-N,2-N-bis(prop-2-enyl)-2,3-dihydroindene-1,2-diamine |
|---|---|
| PubChem CID | 43830997 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 1-butyl-2-N,2-N-bis(prop-2-enyl)-2,3-dihydroindene-1,2-diamine |
| SMILES | C=CCN(CC=C)C1Cc2ccccc2C1(N)CCCC |
| InChI | InChI=1S/C19H28N2/c1-4-7-12-19(20)17-11-9-8-10-16(17)15-18(19)21(13-5-2)14-6-3/h5-6,8-11,18H,2-4,7,12-15,20H2,1H3 |
| InChIKey | DMPZPNRCSMJMPY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|