C18H28N2 — CID 43830945
2-N,2-N-diethyl-1-(2-methylprop-2-enyl)-3,4-dihydro-2H-naphthalene-1,2-diamine (PubChem CID 43830945) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 2-N,2-N-diethyl-1-(2-methylprop-2-enyl)-3,4-dihydro-2H-naphthalene-1,2-diamine.
| Compound Name | 2-N,2-N-diethyl-1-(2-methylprop-2-enyl)-3,4-dihydro-2H-naphthalene-1,2-diamine |
|---|---|
| PubChem CID | 43830945 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 2-N,2-N-diethyl-1-(2-methylprop-2-enyl)-3,4-dihydro-2H-naphthalene-1,2-diamine |
| SMILES | C=C(C)CC1(N)c2ccccc2CCC1N(CC)CC |
| InChI | InChI=1S/C18H28N2/c1-5-20(6-2)17-12-11-15-9-7-8-10-16(15)18(17,19)13-14(3)4/h7-10,17H,3,5-6,11-13,19H2,1-2,4H3 |
| InChIKey | RLDGFYIKDHQOCI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|