C13H16 — CID 174620320
2-ethenyl-2-ethyl-1,3-dihydroindene (PubChem CID 174620320) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-ethenyl-2-ethyl-1,3-dihydroindene.
| Compound Name | 2-ethenyl-2-ethyl-1,3-dihydroindene |
|---|---|
| PubChem CID | 174620320 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 2-ethenyl-2-ethyl-1,3-dihydroindene |
| SMILES | C=CC1(CC)Cc2ccccc2C1 |
| InChI | InChI=1S/C13H16/c1-3-13(4-2)9-11-7-5-6-8-12(11)10-13/h3,5-8H,1,4,9-10H2,2H3 |
| InChIKey | KANKSWWXBFCEOJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|