C26H39NO2Si — CID 20607368
tert-butyl-[[1-[(3-methoxyphenyl)methyl]-4-phenylpiperidin-4-yl]methoxy]-dimethylsilane (PubChem CID 20607368) has the molecular formula C26H39NO2Si and a molecular weight of 425.69 g/mol. Its IUPAC name is tert-butyl-[[1-[(3-methoxyphenyl)methyl]-4-phenylpiperidin-4-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[1-[(3-methoxyphenyl)methyl]-4-phenylpiperidin-4-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 20607368 |
| Molecular Formula | C26H39NO2Si |
| Molecular Weight | 425.69 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | tert-butyl-[[1-[(3-methoxyphenyl)methyl]-4-phenylpiperidin-4-yl]methoxy]-dimethylsilane |
| SMILES | COc1cccc(CN2CCC(CO[Si](C)(C)C(C)(C)C)(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C26H39NO2Si/c1-25(2,3)30(5,6)29-21-26(23-12-8-7-9-13-23)15-17-27(18-16-26)20-22-11-10-14-24(19-22)28-4/h7-14,19H,15-18,20-21H2,1-6H3 |
| InChIKey | WTXLFFXEIGBWSM-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.69 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|