C16H18N2O7 — CID 14936001
ethyl 3-ethoxy-3-imino-2-(6-nitro-2-oxo-3,4-dihydrochromen-4-yl)propanoate (PubChem CID 14936001) has the molecular formula C16H18N2O7 and a molecular weight of 350.33 g/mol. Its IUPAC name is ethyl 3-ethoxy-3-imino-2-(6-nitro-2-oxo-3,4-dihydrochromen-4-yl)propanoate.
| Compound Name | ethyl 3-ethoxy-3-imino-2-(6-nitro-2-oxo-3,4-dihydrochromen-4-yl)propanoate |
|---|---|
| PubChem CID | 14936001 |
| Molecular Formula | C16H18N2O7 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | ethyl 3-ethoxy-3-imino-2-(6-nitro-2-oxo-3,4-dihydrochromen-4-yl)propanoate |
| SMILES | [H]/N=C(\OCC)C(C(=O)OCC)C1CC(=O)Oc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H18N2O7/c1-3-23-15(17)14(16(20)24-4-2)11-8-13(19)25-12-6-5-9(18(21)22)7-10(11)12/h5-7,11,14,17H,3-4,8H2,1-2H3/b17-15- |
| InChIKey | JKGALSPYOCOBNG-ICFOKQHNSA-N |
| XLogP | 2.18 |
| TPSA | 128.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|