C17H22N2O6 — CID 54166996
1-O-tert-butyl 3-O-ethyl (1S)-7-nitro-1,2,3,4-tetrahydroisoquinoline-1,3-dicarboxylate (PubChem CID 54166996) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl (1S)-7-nitro-1,2,3,4-tetrahydroisoquinoline-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl (1S)-7-nitro-1,2,3,4-tetrahydroisoquinoline-1,3-dicarboxylate |
|---|---|
| PubChem CID | 54166996 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl (1S)-7-nitro-1,2,3,4-tetrahydroisoquinoline-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1Cc2ccc([N+](=O)[O-])cc2[C@@H](C(=O)OC(C)(C)C)N1 |
| InChI | InChI=1S/C17H22N2O6/c1-5-24-15(20)13-8-10-6-7-11(19(22)23)9-12(10)14(18-13)16(21)25-17(2,3)4/h6-7,9,13-14,18H,5,8H2,1-4H3/t13?,14-/m0/s1 |
| InChIKey | OSISIXVOMWXGDY-KZUDCZAMSA-N |
| XLogP | 2.06 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|