C21H28N2O8S — CID 131729845
1-O-tert-butyl 3-O-ethyl (2R,3S)-2-(2-cyclopropylsulfonyl-5-nitrophenyl)pyrrolidine-1,3-dicarboxylate (PubChem CID 131729845) has the molecular formula C21H28N2O8S and a molecular weight of 468.53 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl (2R,3S)-2-(2-cyclopropylsulfonyl-5-nitrophenyl)pyrrolidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl (2R,3S)-2-(2-cyclopropylsulfonyl-5-nitrophenyl)pyrrolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 131729845 |
| Molecular Formula | C21H28N2O8S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl (2R,3S)-2-(2-cyclopropylsulfonyl-5-nitrophenyl)pyrrolidine-1,3-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1CCN(C(=O)OC(C)(C)C)[C@H]1c1cc([N+](=O)[O-])ccc1S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C21H28N2O8S/c1-5-30-19(24)15-10-11-22(20(25)31-21(2,3)4)18(15)16-12-13(23(26)27)6-9-17(16)32(28,29)14-7-8-14/h6,9,12,14-15,18H,5,7-8,10-11H2,1-4H3/t15-,18+/m0/s1 |
| InChIKey | SHYZXXYRRVOATH-MAUKXSAKSA-N |
| XLogP | 3.39 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|