C21H30N2O6S — CID 59479514
1-O-tert-butyl 3-O-ethyl (2S,3S)-2-(5-amino-2-cyclopropylsulfonylphenyl)pyrrolidine-1,3-dicarboxylate (PubChem CID 59479514) has the molecular formula C21H30N2O6S and a molecular weight of 438.55 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl (2S,3S)-2-(5-amino-2-cyclopropylsulfonylphenyl)pyrrolidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl (2S,3S)-2-(5-amino-2-cyclopropylsulfonylphenyl)pyrrolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 59479514 |
| Molecular Formula | C21H30N2O6S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl (2S,3S)-2-(5-amino-2-cyclopropylsulfonylphenyl)pyrrolidine-1,3-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1CCN(C(=O)OC(C)(C)C)[C@@H]1c1cc(N)ccc1S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C21H30N2O6S/c1-5-28-19(24)15-10-11-23(20(25)29-21(2,3)4)18(15)16-12-13(22)6-9-17(16)30(26,27)14-7-8-14/h6,9,12,14-15,18H,5,7-8,10-11,22H2,1-4H3/t15-,18-/m0/s1 |
| InChIKey | YSIILEVXTGTXME-YJBOKZPZSA-N |
| XLogP | 3.07 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|