C14H18N2O6S — CID 141196767
(2R,3S)-2-(5-amino-2-ethylsulfonylphenyl)pyrrolidine-1,3-dicarboxylic acid (PubChem CID 141196767) has the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. Its IUPAC name is (2R,3S)-2-(5-amino-2-ethylsulfonylphenyl)pyrrolidine-1,3-dicarboxylic acid.
| Compound Name | (2R,3S)-2-(5-amino-2-ethylsulfonylphenyl)pyrrolidine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 141196767 |
| Molecular Formula | C14H18N2O6S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (2R,3S)-2-(5-amino-2-ethylsulfonylphenyl)pyrrolidine-1,3-dicarboxylic acid |
| SMILES | CCS(=O)(=O)c1ccc(N)cc1[C@H]1[C@@H](C(=O)O)CCN1C(=O)O |
| InChI | InChI=1S/C14H18N2O6S/c1-2-23(21,22)11-4-3-8(15)7-10(11)12-9(13(17)18)5-6-16(12)14(19)20/h3-4,7,9,12H,2,5-6,15H2,1H3,(H,17,18)(H,19,20)/t9-,12+/m0/s1 |
| InChIKey | OVALVYWTIGDOOK-JOYOIKCWSA-N |
| XLogP | 1.19 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|