C14H20N2O2 — CID 68735390
6-amino-1-tert-butyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid (PubChem CID 68735390) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 6-amino-1-tert-butyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid.
| Compound Name | 6-amino-1-tert-butyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 68735390 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 6-amino-1-tert-butyl-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
| SMILES | CC(C)(C)C1c2ccc(N)cc2CCN1C(=O)O |
| InChI | InChI=1S/C14H20N2O2/c1-14(2,3)12-11-5-4-10(15)8-9(11)6-7-16(12)13(17)18/h4-5,8,12H,6-7,15H2,1-3H3,(H,17,18) |
| InChIKey | GVZHERFVFFUYCU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|