C16H23N3O3 — CID 173060435
5-tert-butyl-8-(N'-hydroxycarbamimidoyl)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylic acid (PubChem CID 173060435) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 5-tert-butyl-8-(N'-hydroxycarbamimidoyl)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylic acid.
| Compound Name | 5-tert-butyl-8-(N'-hydroxycarbamimidoyl)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylic acid |
|---|---|
| PubChem CID | 173060435 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 5-tert-butyl-8-(N'-hydroxycarbamimidoyl)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylic acid |
| SMILES | CC(C)(C)C1CN(C(=O)O)CCc2cc(C(N)=NO)ccc21 |
| InChI | InChI=1S/C16H23N3O3/c1-16(2,3)13-9-19(15(20)21)7-6-10-8-11(14(17)18-22)4-5-12(10)13/h4-5,8,13,22H,6-7,9H2,1-3H3,(H2,17,18)(H,20,21) |
| InChIKey | FCLLIAXUNWRVKU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|