4-(N'-hydroxycarbamimidoyl)-2-methylbenzoic acid

C9H10N2O3 — CID 173379142

IUPAC4-(N'-hydroxycarbamimidoyl)-2-methylbenzoic acid
SMILESCc1cc(C(N)=NO)ccc1C(=O)O
InChIInChI=1S/C9H10N2O3/c1-5-4-6(8(10)11-14)2-3-7(5)9(12)13/h2-4,14H,1H3,(H2,10,11)(H,12,13)
InChIKeyWCJGCYBBAPLGHV-UHFFFAOYSA-N
MW194.19 g/mol
LogP0.79
Rot. Bonds2

About 4-(N'-hydroxycarbamimidoyl)-2-methylbenzoic acid

4-(N'-hydroxycarbamimidoyl)-2-methylbenzoic acid (PubChem CID 173379142) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 4-(N'-hydroxycarbamimidoyl)-2-methylbenzoic acid.

Molecular Properties

Compound Name4-(N'-hydroxycarbamimidoyl)-2-methylbenzoic acid
PubChem CID173379142
Molecular FormulaC9H10N2O3
Molecular Weight194.19 g/mol
Exact Mass194.07
IUPAC Name4-(N'-hydroxycarbamimidoyl)-2-methylbenzoic acid
SMILESCc1cc(C(N)=NO)ccc1C(=O)O
InChIInChI=1S/C9H10N2O3/c1-5-4-6(8(10)11-14)2-3-7(5)9(12)13/h2-4,14H,1H3,(H2,10,11)(H,12,13)
InChIKeyWCJGCYBBAPLGHV-UHFFFAOYSA-N
XLogP0.79
TPSA95.91 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.19
LogP ≤ 50.79
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-(N'-hydroxycarbamimidoyl)-2-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(N'-hydroxycarbamimidoyl)-2-methylbenzoic acid?
The IUPAC name of 4-(N'-hydroxycarbamimidoyl)-2-methylbenzoic acid (CID 173379142) is 4-(N'-hydroxycarbamimidoyl)-2-methylbenzoic acid.
What is the SMILES notation for 4-(N'-hydroxycarbamimidoyl)-2-methylbenzoic acid?
The canonical SMILES for 4-(N'-hydroxycarbamimidoyl)-2-methylbenzoic acid is Cc1cc(C(N)=NO)ccc1C(=O)O.
What is the InChIKey of 4-(N'-hydroxycarbamimidoyl)-2-methylbenzoic acid?
The InChIKey is WCJGCYBBAPLGHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3/c1-5-4-6(8(10)11-14)2-3-7(5)9(12)13/h2-4,14H,1H3,(H2,10,11)(H,12,13).
What are the key properties of 4-(N'-hydroxycarbamimidoyl)-2-methylbenzoic acid?
4-(N'-hydroxycarbamimidoyl)-2-methylbenzoic acid has a molecular weight of 194.19 g/mol, XLogP of 0.79, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(N'-hydroxycarbamimidoyl)-2-methylbenzoic acid is sourced from PubChem (CID 173379142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).