C20H24N4O6 — CID 172959722
hydroxylamine;methyl 4-[(E)-N'-hydroxycarbamimidoyl]-2-methylbenzoate;methyl 4-isocyano-2-methylbenzoate (PubChem CID 172959722) has the molecular formula C20H24N4O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is hydroxylamine;methyl 4-[(E)-N'-hydroxycarbamimidoyl]-2-methylbenzoate;methyl 4-isocyano-2-methylbenzoate.
| Compound Name | hydroxylamine;methyl 4-[(E)-N'-hydroxycarbamimidoyl]-2-methylbenzoate;methyl 4-isocyano-2-methylbenzoate |
|---|---|
| PubChem CID | 172959722 |
| Molecular Formula | C20H24N4O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | hydroxylamine;methyl 4-[(E)-N'-hydroxycarbamimidoyl]-2-methylbenzoate;methyl 4-isocyano-2-methylbenzoate |
| SMILES | COC(=O)c1ccc(/C(N)=N\O)cc1C.NO.[C-]#[N+]c1ccc(C(=O)OC)c(C)c1 |
| InChI | InChI=1S/C10H12N2O3.C10H9NO2.H3NO/c1-6-5-7(9(11)12-14)3-4-8(6)10(13)15-2;1-7-6-8(11-2)4-5-9(7)10(12)13-3;1-2/h3-5,14H,1-2H3,(H2,11,12);4-6H,1,3H3;2H,1H2 |
| InChIKey | GTKGFKALABGSMK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 161.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|