C12H20N2O4S2 — CID 15278739
5-amino-N-tert-butyl-2-ethylsulfonylbenzenesulfonamide (PubChem CID 15278739) has the molecular formula C12H20N2O4S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 5-amino-N-tert-butyl-2-ethylsulfonylbenzenesulfonamide.
| Compound Name | 5-amino-N-tert-butyl-2-ethylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 15278739 |
| Molecular Formula | C12H20N2O4S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 5-amino-N-tert-butyl-2-ethylsulfonylbenzenesulfonamide |
| SMILES | CCS(=O)(=O)c1ccc(N)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H20N2O4S2/c1-5-19(15,16)10-7-6-9(13)8-11(10)20(17,18)14-12(2,3)4/h6-8,14H,5,13H2,1-4H3 |
| InChIKey | LSLFSDXZYZJFJO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|