C13H16BrN3O2S2 — CID 137408595
5-amino-2-(5-bromo-1,3-thiazol-2-yl)-N-tert-butylbenzenesulfonamide (PubChem CID 137408595) has the molecular formula C13H16BrN3O2S2 and a molecular weight of 390.33 g/mol. Its IUPAC name is 5-amino-2-(5-bromo-1,3-thiazol-2-yl)-N-tert-butylbenzenesulfonamide.
| Compound Name | 5-amino-2-(5-bromo-1,3-thiazol-2-yl)-N-tert-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 137408595 |
| Molecular Formula | C13H16BrN3O2S2 |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | 5-amino-2-(5-bromo-1,3-thiazol-2-yl)-N-tert-butylbenzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cc(N)ccc1-c1ncc(Br)s1 |
| InChI | InChI=1S/C13H16BrN3O2S2/c1-13(2,3)17-21(18,19)10-6-8(15)4-5-9(10)12-16-7-11(14)20-12/h4-7,17H,15H2,1-3H3 |
| InChIKey | XFLSFPBGJIJCSH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|