C13H22N2O3S — CID 106181343
5-amino-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylbenzenesulfonamide (PubChem CID 106181343) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is 5-amino-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylbenzenesulfonamide.
| Compound Name | 5-amino-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106181343 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 5-amino-N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(N)cc1S(=O)(=O)NC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C13H22N2O3S/c1-9-6-7-10(14)8-11(9)19(17,18)15-12(2,3)13(4,5)16/h6-8,15-16H,14H2,1-5H3 |
| InChIKey | NHAOGVNUCWWVPI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|