C9H14N2O3S — CID 66751883
5-amino-N-(1-hydroxyethyl)-2-methylbenzenesulfonamide (PubChem CID 66751883) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 5-amino-N-(1-hydroxyethyl)-2-methylbenzenesulfonamide.
| Compound Name | 5-amino-N-(1-hydroxyethyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 66751883 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 5-amino-N-(1-hydroxyethyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(N)cc1S(=O)(=O)NC(C)O |
| InChI | InChI=1S/C9H14N2O3S/c1-6-3-4-8(10)5-9(6)15(13,14)11-7(2)12/h3-5,7,11-12H,10H2,1-2H3 |
| InChIKey | AWZFUHAPQGIKHV-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|