C17H18N2O5 — CID 91147266
2-(1-methyl-2-oxoquinolin-4-yl)piperidine-1,3-dicarboxylic acid (PubChem CID 91147266) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is 2-(1-methyl-2-oxoquinolin-4-yl)piperidine-1,3-dicarboxylic acid.
| Compound Name | 2-(1-methyl-2-oxoquinolin-4-yl)piperidine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 91147266 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-(1-methyl-2-oxoquinolin-4-yl)piperidine-1,3-dicarboxylic acid |
| SMILES | Cn1c(=O)cc(C2C(C(=O)O)CCCN2C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C17H18N2O5/c1-18-13-7-3-2-5-10(13)12(9-14(18)20)15-11(16(21)22)6-4-8-19(15)17(23)24/h2-3,5,7,9,11,15H,4,6,8H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | ZMYBDYFJZRCNNT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 99.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |