C20H28N2O8S — CID 59479390
1-O-tert-butyl 3-O-methyl (2S,3S)-2-(5-nitro-2-propan-2-ylsulfonylphenyl)pyrrolidine-1,3-dicarboxylate (PubChem CID 59479390) has the molecular formula C20H28N2O8S and a molecular weight of 456.52 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl (2S,3S)-2-(5-nitro-2-propan-2-ylsulfonylphenyl)pyrrolidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl (2S,3S)-2-(5-nitro-2-propan-2-ylsulfonylphenyl)pyrrolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 59479390 |
| Molecular Formula | C20H28N2O8S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl (2S,3S)-2-(5-nitro-2-propan-2-ylsulfonylphenyl)pyrrolidine-1,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1CCN(C(=O)OC(C)(C)C)[C@@H]1c1cc([N+](=O)[O-])ccc1S(=O)(=O)C(C)C |
| InChI | InChI=1S/C20H28N2O8S/c1-12(2)31(27,28)16-8-7-13(22(25)26)11-15(16)17-14(18(23)29-6)9-10-21(17)19(24)30-20(3,4)5/h7-8,11-12,14,17H,9-10H2,1-6H3/t14-,17-/m0/s1 |
| InChIKey | VCGZDISOJNLQHI-YOEHRIQHSA-N |
| XLogP | 3.25 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|