C18H23N3O7 — CID 54446862
tert-butyl (2S)-2-[(2-methoxy-5-nitrobenzoyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 54446862) has the molecular formula C18H23N3O7 and a molecular weight of 393.40 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2-methoxy-5-nitrobenzoyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(2-methoxy-5-nitrobenzoyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 54446862 |
| Molecular Formula | C18H23N3O7 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | tert-butyl (2S)-2-[(2-methoxy-5-nitrobenzoyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)NC(=O)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H23N3O7/c1-18(2,3)28-17(24)20-9-5-6-13(20)16(23)19-15(22)12-10-11(21(25)26)7-8-14(12)27-4/h7-8,10,13H,5-6,9H2,1-4H3,(H,19,22,23)/t13-/m0/s1 |
| InChIKey | WSDGHOGFQQCVHK-ZDUSSCGKSA-N |
| XLogP | 2.26 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|