C12H16O4S — CID 14792534
diethyl 2-thiabicyclo[2.2.1]hept-5-ene-3,3-dicarboxylate (PubChem CID 14792534) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is diethyl 2-thiabicyclo[2.2.1]hept-5-ene-3,3-dicarboxylate.
| Compound Name | diethyl 2-thiabicyclo[2.2.1]hept-5-ene-3,3-dicarboxylate |
|---|---|
| PubChem CID | 14792534 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | diethyl 2-thiabicyclo[2.2.1]hept-5-ene-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)SC2C=CC1C2 |
| InChI | InChI=1S/C12H16O4S/c1-3-15-10(13)12(11(14)16-4-2)8-5-6-9(7-8)17-12/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | RPTOOANWRASWRE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|