C15H21F2NO4 — CID 102095066
ethyl (1R,2S,4S)-2-(diethylcarbamoyloxy)-3,3-difluorobicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 102095066) has the molecular formula C15H21F2NO4 and a molecular weight of 317.33 g/mol. Its IUPAC name is ethyl (1R,2S,4S)-2-(diethylcarbamoyloxy)-3,3-difluorobicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl (1R,2S,4S)-2-(diethylcarbamoyloxy)-3,3-difluorobicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 102095066 |
| Molecular Formula | C15H21F2NO4 |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | ethyl (1R,2S,4S)-2-(diethylcarbamoyloxy)-3,3-difluorobicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1(OC(=O)N(CC)CC)[C@H]2C=C[C@H](C2)C1(F)F |
| InChI | InChI=1S/C15H21F2NO4/c1-4-18(5-2)13(20)22-14(12(19)21-6-3)10-7-8-11(9-10)15(14,16)17/h7-8,10-11H,4-6,9H2,1-3H3/t10-,11+,14-/m0/s1 |
| InChIKey | LXTUXIRWXMBHNS-WDMOLILDSA-N |
| XLogP | 2.61 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|